What is the molecular formula of (+/-)-Naringenin?
The molecular formula of (+/-)-Naringenin is C15H12O5.
What is the molecular weight of (+/-)-Naringenin?
The molecular weight of (+/-)-Naringenin is 272.25 g/mol.
What are the synonyms of (+/-)-Naringenin?
The synonyms of (+/-)-Naringenin are naringenin, 67604-48-2, 5,7-Dihydroxy-2-(4-hydroxyphenyl)chroman-4-one, 4',5,7-Trihydroxyflavanone.
What is the IUPAC name of (+/-)-Naringenin?
The IUPAC name of (+/-)-Naringenin is 5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one.
What is the InChI of (+/-)-Naringenin?
The InChI of (+/-)-Naringenin is InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-6,13,16-18H,7H2.
What is the InChIKey of (+/-)-Naringenin?
The InChIKey of (+/-)-Naringenin is FTVWIRXFELQLPI-UHFFFAOYSA-N.
What is the canonical SMILES of (+/-)-Naringenin?
The canonical SMILES of (+/-)-Naringenin is C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC=C(C=C3)O.
What is the CAS number of (+/-)-Naringenin?
The CAS number of (+/-)-Naringenin is 67604-48-2.
What is the XLogP3-AA value of (+/-)-Naringenin?
The XLogP3-AA value of (+/-)-Naringenin is 2.4.
What is the hydrogen bond donor count of (+/-)-Naringenin?
The hydrogen bond donor count of (+/-)-Naringenin is 3.