93560-49-7 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C19H22BNO3.
The molecular weight of the compound is 323.2 g/mol.
The IUPAC name of the compound is N-[4-(4,4,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide.
The Canonical SMILES representation of the compound is B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)C3=CC=CC=C3.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor counts.
The exact mass of the compound is 323.1692737 g/mol.
The compound has 3 rotatable bond counts.
The topological polar surface area of the compound is 47.6 Å2.
Yes, the compound is canonicalized.