What is the molecular formula of 2,3-Dihydro-1-oxo asenapine?
The molecular formula of 2,3-Dihydro-1-oxo asenapine is C17H12ClNO2.
What is the molecular weight of 2,3-Dihydro-1-oxo asenapine?
The molecular weight of 2,3-Dihydro-1-oxo asenapine is 297.7 g/mol.
What is the IUPAC name of 2,3-Dihydro-1-oxo asenapine?
The IUPAC name of 2,3-Dihydro-1-oxo asenapine is 9-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.0 2,6 .0 7,12 ]octadeca-1(18),2(6),7(12),8,10,14,16-heptaen-3-one.
What is the InChI of 2,3-Dihydro-1-oxo asenapine?
The InChI of 2,3-Dihydro-1-oxo asenapine is InChI=1S/C17H12ClNO2/c1-19-9-13-12-8-10(18)6-7-15(12)21-14-5-3-2-4-11(14)16(13)17(19)20/h2-8H,9H2,1H3.
What is the InChIKey of 2,3-Dihydro-1-oxo asenapine?
The InChIKey of 2,3-Dihydro-1-oxo asenapine is UEFINICFHHBHJQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Dihydro-1-oxo asenapine?
The canonical SMILES of 2,3-Dihydro-1-oxo asenapine is CN1CC2=C(C1=O)C3=CC=CC=C3OC4=C2C=C(C=C4)Cl.
What is the XLogP3-AA value of 2,3-Dihydro-1-oxo asenapine?
The XLogP3-AA value of 2,3-Dihydro-1-oxo asenapine is 2.9.
How many hydrogen bond donor count does 2,3-Dihydro-1-oxo asenapine have?
2,3-Dihydro-1-oxo asenapine has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does 2,3-Dihydro-1-oxo asenapine have?
2,3-Dihydro-1-oxo asenapine has 2 hydrogen bond acceptor count.
What is the topological polar surface area of 2,3-Dihydro-1-oxo asenapine?
The topological polar surface area of 2,3-Dihydro-1-oxo asenapine is 29.5 ?2.
※ Please kindly note that our products are for research use only.