What is the molecular formula of acetylcholine bromide?
The molecular formula of acetylcholine bromide is C7H16BrNO2.
What is the molecular weight of acetylcholine bromide?
The molecular weight of acetylcholine bromide is 226.11 g/mol.
What is the IUPAC name of acetylcholine bromide?
The IUPAC name of acetylcholine bromide is 2-acetyloxyethyl(trimethyl)azanium bromide.
What is the InChIKey of acetylcholine bromide?
The InChIKey of acetylcholine bromide is ZEHGKSPCAMLJDC-UHFFFAOYSA-M.
What is the canonical SMILES of acetylcholine bromide?
The canonical SMILES of acetylcholine bromide is CC(=O)OCC[N+](C)(C)C.[Br-].
What is the CAS number of acetylcholine bromide?
The CAS number of acetylcholine bromide is 66-23-9.
What is the hydrobromic acid component compound of acetylcholine bromide?
The hydrobromic acid component compound of acetylcholine bromide is CID 260.
What is the parent compound of acetylcholine bromide?
The parent compound of acetylcholine bromide is acetylcholine, represented by CID 187.
What is the complexity of acetylcholine bromide?
The complexity of acetylcholine bromide is 115, computed by Cactvs 3.4.8.18.
What is the medical significance of acetylcholine bromide?
Acetylcholine bromide is a neurotransmitter found at neuromuscular junctions, autonomic ganglia, parasympathetic effector junctions, a subset of sympathetic effector junctions, and at many sites in the central nervous system.
※ Please kindly note that our products are for research use only.
Download
