93438-37-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H13IN2Si.
The IUPAC name of the compound is (4-iodopyrrolo[2,3-b]pyridin-1-yl)-trimethylsilane.
The InChI code of the compound is InChI=1S/C10H13IN2Si/c1-14(2,3)13-7-5-8-9(11)4-6-12-10(8)13/h4-7H,1-3H3.
The InChIKey of the compound is DWAWRLFPOXHKNA-UHFFFAOYSA-N.
The canonical SMILES representation of the compound is C[Si](C)(C)N1C=CC2=C(C=CN=C21)I.
The molecular weight of the compound is 316.21 g/mol.
The compound has 0 hydrogen bond donors.
The compound has 1 hydrogen bond acceptor.
The compound has 1 rotatable bond.
The topological polar surface area of the compound is 17.8 Å2.