934175-49-2 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C14H19NO2.
The molecular weight of the compound is 233.31 g/mol.
The IUPAC name of the compound is 7-benzyl-3-oxa-7-azabicyclo[3.3.1]nonan-9-ol.
The InChI of the compound is InChI=1S/C14H19NO2/c16-14-12-7-15(8-13(14)10-17-9-12)6-11-4-2-1-3-5-11/h1-5,12-14,16H,6-10H2.
The InChIKey of the compound is FCQHVMVLHYLCFT-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1C2COCC(C2O)CN1CC3=CC=CC=C3.
The XLogP3-AA value of the compound is 1.1.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor counts.
The compound has 2 rotatable bond counts.