What is the molecular formula of H-Ala-Val-Leu-OH?
The molecular formula is C14H27N3O4.
What is the molecular weight of H-Ala-Val-Leu-OH?
The molecular weight is 301.38 g/mol.
What is the IUPAC name of H-Ala-Val-Leu-OH?
The IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoic acid.
What is the InChI of H-Ala-Val-Leu-OH?
The InChI is InChI=1S/C14H27N3O4/c1-7(2)6-10(14(20)21)16-13(19)11(8(3)4)17-12(18)9(5)15/h7-11H,6,15H2,1-5H3,(H,16,19)(H,17,18)(H,20,21)/t9-,10-,11-/m0/s1.
What is the InChIKey of H-Ala-Val-Leu-OH?
The InChIKey is RFJNDTQGEJRBHO-DCAQKATOSA-N.
What is the Canonical SMILES of H-Ala-Val-Leu-OH?
The Canonical SMILES is CC(C)CC(C(=O)O)NC(=O)C(C(C)C)NC(=O)C(C)N.
What is the XLogP3 value of H-Ala-Val-Leu-OH?
The XLogP3 value is -2.8.
How many hydrogen bond donor counts does H-Ala-Val-Leu-OH have?
H-Ala-Val-Leu-OH has 4 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does H-Ala-Val-Leu-OH have?
H-Ala-Val-Leu-OH has 5 hydrogen bond acceptor counts.
How many rotatable bond counts does H-Ala-Val-Leu-OH have?
H-Ala-Val-Leu-OH has 8 rotatable bond counts.