What is the molecular formula of 3H-Imidazo[4,5-c]pyridine-4-carboxylic acid?
The molecular formula is C7H5N3O2.
What is the molecular weight of 3H-Imidazo[4,5-c]pyridine-4-carboxylic acid?
The molecular weight is 163.13 g/mol.
What is the IUPAC name of 3H-Imidazo[4,5-c]pyridine-4-carboxylic acid?
The IUPAC name is 1H-imidazo[4,5-c]pyridine-4-carboxylic acid.
What is the InChI of 3H-Imidazo[4,5-c]pyridine-4-carboxylic acid?
The InChI is InChI=1S/C7H5N3O2/c11-7(12)6-5-4(1-2-8-6)9-3-10-5/h1-3H,(H,9,10)(H,11,12).
What is the InChIKey of 3H-Imidazo[4,5-c]pyridine-4-carboxylic acid?
The InChIKey is MYYGVHLIIVDANU-UHFFFAOYSA-N.
What is the Canonical SMILES of 3H-Imidazo[4,5-c]pyridine-4-carboxylic acid?
The Canonical SMILES is C1=CN=C(C2=C1NC=N2)C(=O)O.
What is the CAS number of 3H-Imidazo[4,5-c]pyridine-4-carboxylic acid?
The CAS number is 933728-33-7.
What is the DSSTox Substance ID of 3H-Imidazo[4,5-c]pyridine-4-carboxylic acid?
The DSSTox Substance ID is DTXSID80669053.
What is the XLogP3-AA value of 3H-Imidazo[4,5-c]pyridine-4-carboxylic acid?
The XLogP3-AA value is 0.3.
Is 3H-Imidazo[4,5-c]pyridine-4-carboxylic acid a canonicalized compound?
Yes, it is a canonicalized compound.