CAS
933696-71-0 Purity
97%
933696-71-0 Purity
97%
Shopping basket
1H-3-Benzazepin-1-amine,2,3,4,5-tetrahydro-
CAS
933698-87-4
Catalog Number
ACM933698874
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the chemical name of the compound?
The chemical name of the compound is 2,3,4,5-tetrahydro-1H-3-benzazepin-5-amine.
What is the molecular formula of the compound?
The molecular formula of the compound is C10H14N2.
What is the molecular weight of the compound?
The molecular weight of the compound is 162.23 g/mol.
When was the compound created?
The compound was created on January 24, 2012.
When was the compound last modified?
The compound was last modified on December 30, 2023.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C10H14N2/c11-10-7-12-6-5-8-3-1-2-4-9(8)10/h1-4,10,12H,5-7,11H2.
What is the InChIKey of the compound?
The InChIKey of the compound is HHUBTWXIUNJDHO-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is C1CNCC(C2=CC=CC=C21)N.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.4.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
Recommended Products
![5-methylH-imidazo[1,2-a]pyridine](https://resource.alfa-chemistry.com/structure/933-69-7.gif)
