What is the molecular formula of 3-Hydroxypicolinamide?
The molecular formula of 3-Hydroxypicolinamide is C6H6N2O2.
What is the molecular weight of 3-Hydroxypicolinamide?
The molecular weight of 3-Hydroxypicolinamide is 138.12 g/mol.
What is the IUPAC name of 3-Hydroxypicolinamide?
The IUPAC name of 3-Hydroxypicolinamide is 3-hydroxypyridine-2-carboxamide.
What is the InChI of 3-Hydroxypicolinamide?
The InChI of 3-Hydroxypicolinamide is InChI=1S/C6H6N2O2/c7-6(10)5-4(9)2-1-3-8-5/h1-3,9H,(H2,7,10).
What is the InChIKey of 3-Hydroxypicolinamide?
The InChIKey of 3-Hydroxypicolinamide is VIHUZJYFQOEUMI-UHFFFAOYSA-N.
What is the CAS number of 3-Hydroxypicolinamide?
The CAS number of 3-Hydroxypicolinamide is 933-90-4.
What is the XLogP3 value of 3-Hydroxypicolinamide?
The XLogP3 value of 3-Hydroxypicolinamide is 0.7.
How many hydrogen bond donor counts are there in 3-Hydroxypicolinamide?
There are 2 hydrogen bond donor counts in 3-Hydroxypicolinamide.
How many hydrogen bond acceptor counts are there in 3-Hydroxypicolinamide?
There are 3 hydrogen bond acceptor counts in 3-Hydroxypicolinamide.
What is the topological polar surface area of 3-Hydroxypicolinamide?
The topological polar surface area of 3-Hydroxypicolinamide is 76.2 ?^2.