The molecular formula of the compound is C13H15ClN2O.
What are the synonyms for the compound?
The synonyms for the compound are 3-Chloro-N-[2-(1H-indol-3-yl)ethyl]propanamide, 93187-18-9, N-(2-(1H-Indol-3-yl)ethyl)-3-chloropropanamide, and 3-Chloro-N-(2-indol-3-ylethyl)propanamide.
What is the molecular weight of the compound?
The molecular weight of the compound is 250.72 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 3-chloro-N-[2-(1H-indol-3-yl)ethyl]propanamide.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C13H15ClN2O/c14-7-5-13(17)15-8-6-10-9-16-12-4-2-1-3-11(10)12/h1-4,9,16H,5-8H2,(H,15,17).
What is the InChIKey of the compound?
The InChIKey of the compound is OPKXWASJTNADKA-UHFFFAOYSA-N.
What is the canonical SMILES representation of the compound?
The canonical SMILES representation of the compound is C1=CC=C2C(=C1)C(=CN2)CCNC(=O)CCCl.
What is the CAS number of the compound?
The CAS number of the compound is 93187-18-9.
What is the XLogP3 value of the compound?
The XLogP3 value of the compound is 2.3.
Is the compound a covalently-bonded unit?
Yes, the compound is a covalently-bonded unit.
※ Please kindly note that our products are for research use only.