What is the molecular formula of 4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzylamine?
The molecular formula is C12H15N3.
What is the molecular weight of 4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzylamine?
The molecular weight is 201.27 g/mol.
What is the IUPAC name of 4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzylamine?
The IUPAC name is [4-(3,5-dimethylpyrazol-1-yl)phenyl]methanamine.
What is the InChI of 4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzylamine?
The InChI is InChI=1S/C12H15N3/c1-9-7-10(2)15(14-9)12-5-3-11(8-13)4-6-12/h3-7H,8,13H2,1-2H3.
What is the InChIKey of 4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzylamine?
The InChIKey is PARNNKGLJSIUFI-UHFFFAOYSA-N.
How many hydrogen bond donor counts are there in 4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzylamine?
There is 1 hydrogen bond donor count.
What is the topological polar surface area of 4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzylamine?
The topological polar surface area is 43.8 Ų.
Is 4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzylamine a canonicalized compound?
Yes, it is a canonicalized compound.
What is the XLogP3-AA value of 4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzylamine?
The XLogP3-AA value is 1.5.
What is the exact mass of 4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzylamine?
The exact mass is 201.126597491 g/mol.