What is the molecular formula of 1-Phenyl-1,3-butanedione?
The molecular formula of 1-Phenyl-1,3-butanedione is C10H10O2.
What is the molecular weight of 1-Phenyl-1,3-butanedione?
The molecular weight of 1-Phenyl-1,3-butanedione is 162.18 g/mol.
What is the IUPAC name of 1-Phenyl-1,3-butanedione?
The IUPAC name of 1-Phenyl-1,3-butanedione is 1-phenylbutane-1,3-dione.
What is the InChI of 1-Phenyl-1,3-butanedione?
The InChI of 1-Phenyl-1,3-butanedione is InChI=1S/C10H10O2/c1-8(11)7-10(12)9-5-3-2-4-6-9/h2-6H,7H2,1H3.
What is the InChIKey of 1-Phenyl-1,3-butanedione?
The InChIKey of 1-Phenyl-1,3-butanedione is CVBUKMMMRLOKQR-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Phenyl-1,3-butanedione?
The canonical SMILES of 1-Phenyl-1,3-butanedione is CC(=O)CC(=O)C1=CC=CC=C1.
What is the CAS number of 1-Phenyl-1,3-butanedione?
The CAS number of 1-Phenyl-1,3-butanedione is 93-91-4.
What is the EC number of 1-Phenyl-1,3-butanedione?
The EC number of 1-Phenyl-1,3-butanedione is 202-286-4.
What is the XLogP3 value of 1-Phenyl-1,3-butanedione?
The XLogP3 value of 1-Phenyl-1,3-butanedione is 1.6.
What is the topological polar surface area of 1-Phenyl-1,3-butanedione?
The topological polar surface area of 1-Phenyl-1,3-butanedione is 34.1 ?2.