What is the molecular formula of 1-Phenyl-1,2-ethanediol?
The molecular formula of 1-Phenyl-1,2-ethanediol is C8H10O2.
What is the molecular weight of 1-Phenyl-1,2-ethanediol?
The molecular weight of 1-Phenyl-1,2-ethanediol is 138.16 g/mol.
What is the IUPAC name of 1-Phenyl-1,2-ethanediol?
The IUPAC name of 1-Phenyl-1,2-ethanediol is 1-phenylethane-1,2-diol.
What is the InChI of 1-Phenyl-1,2-ethanediol?
The InChI of 1-Phenyl-1,2-ethanediol is InChI=1S/C8H10O2/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8-10H,6H2.
What is the InChIKey of 1-Phenyl-1,2-ethanediol?
The InChIKey of 1-Phenyl-1,2-ethanediol is PWMWNFMRSKOCEY-UHFFFAOYSA-N.
What is the canonical SMILES representation of 1-Phenyl-1,2-ethanediol?
The canonical SMILES representation of 1-Phenyl-1,2-ethanediol is C1=CC=C(C=C1)C(CO)O.
What is the CAS number of 1-Phenyl-1,2-ethanediol?
The CAS number of 1-Phenyl-1,2-ethanediol is 93-56-1.
What is the ChEMBL ID of 1-Phenyl-1,2-ethanediol?
The ChEMBL ID of 1-Phenyl-1,2-ethanediol is CHEMBL3188703.
What is the hydrogen bond donor count of 1-Phenyl-1,2-ethanediol?
The hydrogen bond donor count of 1-Phenyl-1,2-ethanediol is 2.