What is the molecular formula of Fmoc-tyr-oh?
The molecular formula of Fmoc-tyr-oh is C24H21NO5.
What is the molecular weight of Fmoc-tyr-oh?
The molecular weight of Fmoc-tyr-oh is 403.4 g/mol.
What is the IUPAC name of Fmoc-tyr-oh?
The IUPAC name of Fmoc-tyr-oh is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxyphenyl)propanoic acid.
What is the InChI of Fmoc-tyr-oh?
The InChI of Fmoc-tyr-oh is InChI=1S/C24H21NO5/c26-16-11-9-15(10-12-16)13-22(23(27)28)25-24(29)30-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22,26H,13-14H2,(H,25,29)(H,27,28)/t22-/m0/s1.
What is the InChIKey of Fmoc-tyr-oh?
The InChIKey of Fmoc-tyr-oh is SWZCTMTWRHEBIN-QFIPXVFZSA-N.
What is the canonical SMILES of Fmoc-tyr-oh?
The canonical SMILES of Fmoc-tyr-oh is C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CC=C(C=C4)O)C(=O)O.
What is the isomeric SMILES of Fmoc-tyr-oh?
The isomeric SMILES of Fmoc-tyr-oh is C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)O)C(=O)O.
What is the CAS number of Fmoc-tyr-oh?
The CAS number of Fmoc-tyr-oh is 92954-90-0.
What is the ChEMBL ID of Fmoc-tyr-oh?
The ChEMBL ID of Fmoc-tyr-oh is CHEMBL562672.
Is the compound Fmoc-tyr-oh canonicalized?
Yes, the compound Fmoc-tyr-oh is canonicalized.