What is the molecular formula of (+)-Tropicamide?
The molecular formula of (+)-Tropicamide is C17H20N2O2.
What is the molecular weight of (+)-Tropicamide?
The molecular weight of (+)-Tropicamide is 284.35 g/mol.
What is the IUPAC name of (+)-Tropicamide?
The IUPAC name of (+)-Tropicamide is (2R)-N-ethyl-3-hydroxy-2-phenyl-N-(pyridin-4-ylmethyl)propanamide.
What is the InChI of (+)-Tropicamide?
The InChI of (+)-Tropicamide is InChI=1S/C17H20N2O2/c1-2-19(12-14-8-10-18-11-9-14)17(21)16(13-20)15-6-4-3-5-7-15/h3-11,16,20H,2,12-13H2,1H3/t16-/m0/s1.
What is the InChIKey of (+)-Tropicamide?
The InChIKey of (+)-Tropicamide is BGDKAVGWHJFAGW-INIZCTEOSA-N.
What is the canonical SMILES of (+)-Tropicamide?
The canonical SMILES of (+)-Tropicamide is CCN(CC1=CC=NC=C1)C(=O)C(CO)C2=CC=CC=C2.
What is the isomeric SMILES of (+)-Tropicamide?
The isomeric SMILES of (+)-Tropicamide is CCN(CC1=CC=NC=C1)C(=O)[C@@H](CO)C2=CC=CC=C2.
What is the CAS number of (+)-Tropicamide?
The CAS number of (+)-Tropicamide is 92934-63-9.
What is the UNII of (+)-Tropicamide?
The UNII of (+)-Tropicamide is RD4LZH1NOL.
What is the ChEMBL ID of (+)-Tropicamide?
The ChEMBL ID of (+)-Tropicamide is CHEMBL1457550.