What is the molecular formula of 7-Formylheptanoic acid?
The molecular formula of 7-Formylheptanoic acid is C8H14O3.
What is the molecular weight of 7-Formylheptanoic acid?
The molecular weight of 7-Formylheptanoic acid is 158.19 g/mol.
What is the IUPAC name of 7-Formylheptanoic acid?
The IUPAC name of 7-Formylheptanoic acid is 8-oxooctanoic acid.
What is the InChI of 7-Formylheptanoic acid?
The InChI of 7-Formylheptanoic acid is InChI=1S/C8H14O3/c9-7-5-3-1-2-4-6-8(10)11/h7H,1-6H2,(H,10,11).
What is the InChIKey of 7-Formylheptanoic acid?
The InChIKey of 7-Formylheptanoic acid is UEXYJHLCLUYOFA-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Formylheptanoic acid?
The canonical SMILES of 7-Formylheptanoic acid is C(CCCC(=O)O)CCC=O.
What is the CAS number of 7-Formylheptanoic acid?
The CAS number of 7-Formylheptanoic acid is 929-48-6.
What is the European Community (EC) number of 7-Formylheptanoic acid?
The European Community (EC) number of 7-Formylheptanoic acid is 213-199-6.
What is the Lipid Maps ID (LM_ID) of 7-Formylheptanoic acid?
The Lipid Maps ID (LM_ID) of 7-Formylheptanoic acid is LMFA01060212.
Is 7-Formylheptanoic acid a covalently-bonded unit?
Yes, 7-Formylheptanoic acid is a covalently-bonded unit.