CAS
92869-77-7 Purity
---
92869-77-7 Purity
---
Shopping basket
1-Benzyl-5,5-diethylbarbituric acid
CAS
92870-36-5
Catalog Number
ACM92870365
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 1-Benzyl-5,5-diethylbarbituric acid?
The molecular formula of 1-Benzyl-5,5-diethylbarbituric acid is C15H18N2O3.
When was 1-Benzyl-5,5-diethylbarbituric acid created?
1-Benzyl-5,5-diethylbarbituric acid was created on July 14, 2005.
What is the IUPAC name of 1-Benzyl-5,5-diethylbarbituric acid?
The IUPAC name of 1-Benzyl-5,5-diethylbarbituric acid is 1-benzyl-5,5-diethyl-1,3-diazinane-2,4,6-trione.
What is the InChI of 1-Benzyl-5,5-diethylbarbituric acid?
The InChI of 1-Benzyl-5,5-diethylbarbituric acid is InChI=1S/C15H18N2O3/c1-3-15(4-2)12(18)16-14(20)17(13(15)19)10-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3,(H,16,18,20).
How many hydrogen bond donor counts does 1-Benzyl-5,5-diethylbarbituric acid have?
1-Benzyl-5,5-diethylbarbituric acid has 1 hydrogen bond donor count.
What is the topological polar surface area of 1-Benzyl-5,5-diethylbarbituric acid?
The topological polar surface area of 1-Benzyl-5,5-diethylbarbituric acid is 66.5 Ų.
How many rotatable bond counts does 1-Benzyl-5,5-diethylbarbituric acid have?
1-Benzyl-5,5-diethylbarbituric acid has 4 rotatable bond counts.
Is 1-Benzyl-5,5-diethylbarbituric acid a canonicalized compound?
Yes, 1-Benzyl-5,5-diethylbarbituric acid is a canonicalized compound.
What is the exact mass of 1-Benzyl-5,5-diethylbarbituric acid?
The exact mass of 1-Benzyl-5,5-diethylbarbituric acid is 274.13174244 g/mol.
What is the computed molecular weight of 1-Benzyl-5,5-diethylbarbituric acid?
The computed molecular weight of 1-Benzyl-5,5-diethylbarbituric acid is 274.31 g/mol.
Recommended Products
