CAS
92810-82-7 Purity
96%
92810-82-7 Purity
96%
Shopping basket
Phenol, 2-Amino-6-Fluoro-4-Nitro-
CAS
928118-13-2
Catalog Number
ACM928118132
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-amino-6-fluoro-4-nitrophenol.
What is the molecular formula of the compound?
The molecular formula of the compound is C6H5FN2O3.
What is the molecular weight of the compound?
The molecular weight of the compound is 172.11 g/mol.
What is the InChIKey of the compound?
The InChIKey of the compound is IEUSTEIALPMDEF-UHFFFAOYSA-N.
What is the canonical SMILES representation of the compound?
The canonical SMILES representation of the compound is C1=C(C=C(C(=C1N)O)F)[N+](=O)[O-].
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 5 hydrogen bond acceptor counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 92.1Ų.
How many heavy atom counts does the compound have?
The compound has 12 heavy atom counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Please kindly note that our products are for research use only.
Recommended Products
CAS
928118-00-7 Purity
96%
928118-00-7 Purity
96%
