What is the molecular formula of 2-Isobutylmorpholine?
The molecular formula of 2-Isobutylmorpholine is C8H17NO.
What is the molecular weight of 2-Isobutylmorpholine?
The molecular weight of 2-Isobutylmorpholine is 143.23 g/mol.
What is the IUPAC name of 2-Isobutylmorpholine?
The IUPAC name of 2-Isobutylmorpholine is 2-(2-methylpropyl)morpholine.
What is the InChI of 2-Isobutylmorpholine?
The InChI of 2-Isobutylmorpholine is InChI=1S/C8H17NO/c1-7(2)5-8-6-9-3-4-10-8/h7-9H,3-6H2,1-2H3.
What is the InChIKey of 2-Isobutylmorpholine?
The InChIKey of 2-Isobutylmorpholine is HNDXEVBVCNVVOW-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Isobutylmorpholine?
The Canonical SMILES of 2-Isobutylmorpholine is CC(C)CC1CNCCO1.
How many hydrogen bond donor counts does 2-Isobutylmorpholine have?
2-Isobutylmorpholine has 1 hydrogen bond donor count.
What is the topological polar surface area of 2-Isobutylmorpholine?
The topological polar surface area of 2-Isobutylmorpholine is 21.3 Å2.
Is 2-Isobutylmorpholine considered as a canonicalized compound?
Yes, 2-Isobutylmorpholine is considered a canonicalized compound.
When was 2-Isobutylmorpholine created and last modified?
2-Isobutylmorpholine was created on December 5, 2007 and last modified on December 30, 2023.