What is the PubChem CID of L-Leucine-d7?
The PubChem CID of L-Leucine-d7 is 71309641.
What is the molecular formula of L-Leucine-d7?
The molecular formula of L-Leucine-d7 is C6H13NO2.
What are the synonyms of L-Leucine-d7?
The synonyms of L-Leucine-d7 are L-LEUCINE-D7, 92751-17-2, (2S)-2-amino-4,5,5,5-tetradeuterio-4-(trideuteriomethyl)pentanoic acid, SCHEMBL16807357, and L-LEUCINE (ISOPROPYL-D7).
What is the molecular weight of L-Leucine-d7?
The molecular weight of L-Leucine-d7 is 138.22 g/mol.
What is the IUPAC name of L-Leucine-d7?
The IUPAC name of L-Leucine-d7 is (2S)-2-amino-4,5,5,5-tetradeuterio-4-(trideuteriomethyl)pentanoic acid.
What is the InChI of L-Leucine-d7?
The InChI of L-Leucine-d7 is InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i1D3,2D3,4D.
What is the InChIKey of L-Leucine-d7?
The InChIKey of L-Leucine-d7 is ROHFNLRQFUQHCH-RHMGQHGKSA-N.
What is the canonical SMILES of L-Leucine-d7?
The canonical SMILES of L-Leucine-d7 is CC(C)CC(C(=O)O)N.
What is the isomeric SMILES of L-Leucine-d7?
The isomeric SMILES of L-Leucine-d7 is [2H]C([2H])([2H])C([2H])(C[C@@H](C(=O)O)N)C([2H])([2H])[2H].
What is the Nikkaji Number of L-Leucine-d7?
The Nikkaji Number of L-Leucine-d7 is J3.612.697C.