What is the molecular formula of 3-Methyl-2-(octa-1,7-diynyl)pyridine?
The molecular formula is C14H15N.
When was 3-Methyl-2-(octa-1,7-diynyl)pyridine created and last modified?
It was created on April 16, 2007, and last modified on December 30, 2023.
What is the IUPAC name of 3-Methyl-2-(octa-1,7-diynyl)pyridine?
The IUPAC name is 3-methyl-2-octa-1,7-diynylpyridine.
What is the InChI of 3-Methyl-2-(octa-1,7-diynyl)pyridine?
The InChI is InChI=1S/C14H15N/c1-3-4-5-6-7-8-11-14-13(2)10-9-12-15-14/h1,9-10,12H,4-7H2,2H3.
How many hydrogen bond donor counts does 3-Methyl-2-(octa-1,7-diynyl)pyridine have?
It has 0 hydrogen bond donor counts.
What is the topological polar surface area of 3-Methyl-2-(octa-1,7-diynyl)pyridine?
The topological polar surface area is 12.9 Ų.
How many defined bond stereocenter counts does 3-Methyl-2-(octa-1,7-diynyl)pyridine have?
It has 0 defined bond stereocenter counts.
Is 3-Methyl-2-(octa-1,7-diynyl)pyridine a canonicalized compound according to PubChem?
Yes, it is a canonicalized compound.
What is the exact mass of 3-Methyl-2-(octa-1,7-diynyl)pyridine?
The exact mass is 197.120449483 g/mol.
How many covalently-bonded unit counts does 3-Methyl-2-(octa-1,7-diynyl)pyridine have?
It has 1 covalently-bonded unit count.