What is the molecular formula of N-Cbz-nortropine?
The molecular formula of N-Cbz-nortropine is C15H19NO3.
When was N-Cbz-nortropine created and last modified?
N-Cbz-nortropine was created on May 28, 2009, and last modified on December 30, 2023.
What is the IUPAC name of N-Cbz-nortropine?
The IUPAC name of N-Cbz-nortropine is benzyl (1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate.
What is the Canonical SMILES of N-Cbz-nortropine?
The Canonical SMILES of N-Cbz-nortropine is C1CC2CC(CC1N2C(=O)OCC3=CC=CC=C3)O.
How many hydrogen bond donor counts does N-Cbz-nortropine have?
N-Cbz-nortropine has 1 hydrogen bond donor count.
What is the topological polar surface area of N-Cbz-nortropine?
The topological polar surface area of N-Cbz-nortropine is 49.8 angstrom squared.
How many hydrogen bond acceptor counts does N-Cbz-nortropine have?
N-Cbz-nortropine has 3 hydrogen bond acceptor counts.
What is the XLogP3-AA value of N-Cbz-nortropine?
The XLogP3-AA value of N-Cbz-nortropine is 2.1.
How many defined atom stereocenter counts does N-Cbz-nortropine have?
N-Cbz-nortropine has 2 defined atom stereocenter counts.
Is N-Cbz-nortropine a canonicalized compound?
Yes, N-Cbz-nortropine is a canonicalized compound.