The molecular formula of the compound is C15H20N2.
What are the synonyms for the compound?
The synonyms for the compound are 3-(2-(piperidin-2-yl)ethyl)-1H-indole, 92647-73-9, 3-[2-(piperidin-2-yl)ethyl]-1H-indole, DTXSID80698702, 3-[2-(2-piperidinyl)ethyl]-1H-indole.
When was the compound created?
The compound was created on October 30, 2011.
When was the compound last modified?
The compound was last modified on December 30, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 3-(2-piperidin-2-ylethyl)-1H-indole.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C15H20N2/c1-2-7-15-14(6-1)12(11-17-15)8-9-13-5-3-4-10-16-13/h1-2,6-7,11,13,16-17H,3-5,8-10H2.
What is the InChIKey of the compound?
The InChIKey of the compound is INESWDCREILNOK-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1CCNC(C1)CCC2=CNC3=CC=CC=C32.
What is the molecular weight of the compound?
The molecular weight of the compound is 228.33 g/mol.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
※ Please kindly note that our products are for research use only.