What is the molecular formula of Benoxathian?
The molecular formula of Benoxathian is C19H23NO4S.
When was Benoxathian first created?
Benoxathian was first created on March 25, 2005.
What is the molecular weight of Benoxathian?
The molecular weight of Benoxathian is 361.5 g/mol.
What is the InChI of Benoxathian?
The InChI of Benoxathian is InChI=1S/C19H23NO4S/c1-21-16-7-5-8-17(22-2)19(16)23-11-10-20-12-14-13-25-18-9-4-3-6-15(18)24-14/h3-9,14,20H,10-13H2,1-2H3.
How many hydrogen bond donor counts does Benoxathian have?
Benoxathian has 1 hydrogen bond donor count.
What is the topological polar surface area of Benoxathian?
The topological polar surface area of Benoxathian is 74.2 Å2.
Does Benoxathian have any isotope atom counts?
Benoxathian does not have any isotope atom counts.
What is the formal charge of Benoxathian?
The formal charge of Benoxathian is 0.
How many rotatable bond counts does Benoxathian have?
Benoxathian has 8 rotatable bond counts.
Is Benoxathian a canonicalized compound?
Yes, Benoxathian is a canonicalized compound.