What is the molecular formula of Ethanone, 2-(3-fluorophenyl)-1-(1-piperazinyl)?
The molecular formula is C12H15FN2O.
What is the molecular weight of Ethanone, 2-(3-fluorophenyl)-1-(1-piperazinyl)?
The molecular weight is 222.26 g/mol.
What is the IUPAC name of Ethanone, 2-(3-fluorophenyl)-1-(1-piperazinyl)?
The IUPAC name is 2-(3-fluorophenyl)-1-piperazin-1-ylethanone.
What is the InChI of Ethanone, 2-(3-fluorophenyl)-1-(1-piperazinyl)?
The InChI is InChI=1S/C12H15FN2O/c13-11-3-1-2-10(8-11)9-12(16)15-6-4-14-5-7-15/h1-3,8,14H,4-7,9H2.
What is the InChIKey of Ethanone, 2-(3-fluorophenyl)-1-(1-piperazinyl)?
The InChIKey is ALMOQPWOZJNGSD-UHFFFAOYSA-N.
What is the canonical SMILES of Ethanone, 2-(3-fluorophenyl)-1-(1-piperazinyl)?
The canonical SMILES is C1CN(CCN1)C(=O)CC2=CC(=CC=C2)F.
How many hydrogen bond donor counts does Ethanone, 2-(3-fluorophenyl)-1-(1-piperazinyl) have?
Ethanone has 1 hydrogen bond donor count.
What is the exact mass of Ethanone, 2-(3-fluorophenyl)-1-(1-piperazinyl)?
The exact mass is 222.11684127 g/mol.
What is the topological polar surface area of Ethanone, 2-(3-fluorophenyl)-1-(1-piperazinyl)?
The topological polar surface area is 32.3 Å2.
Is the compound canonicalized for Ethanone, 2-(3-fluorophenyl)-1-(1-piperazinyl)?
Yes, the compound is canonicalized.