What is the molecular formula of Chembrdg-bb 5663117?
The molecular formula of Chembrdg-bb 5663117 is C15H13N3O3.
What is the molecular weight of Chembrdg-bb 5663117?
The molecular weight of Chembrdg-bb 5663117 is 283.28 g/mol.
When was Chembrdg-bb 5663117 created?
Chembrdg-bb 5663117 was created on July 8, 2005.
When was Chembrdg-bb 5663117 last modified?
Chembrdg-bb 5663117 was last modified on December 30, 2023.
What is the IUPAC name of Chembrdg-bb 5663117?
The IUPAC name of Chembrdg-bb 5663117 is "(1-benzyl-5-nitrobenzimidazol-2-yl)methanol".
What is the InChIKey of Chembrdg-bb 5663117?
The InChIKey of Chembrdg-bb 5663117 is "AIFMIOUEZIFEAH-UHFFFAOYSA-N".
What is the canonical SMILES representation of Chembrdg-bb 5663117?
The canonical SMILES representation of Chembrdg-bb 5663117 is "C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)[N+](=O)[O-])N=C2CO".
What is the XLogP3-AA value of Chembrdg-bb 5663117?
The XLogP3-AA value of Chembrdg-bb 5663117 is 2.
How many hydrogen bond donor counts does Chembrdg-bb 5663117 have?
Chembrdg-bb 5663117 has 1 hydrogen bond donor count.
How many rotatable bond counts does Chembrdg-bb 5663117 have?
Chembrdg-bb 5663117 has 3 rotatable bond counts.