What is the molecular formula of Ethyl 3-(4-bromo-1H-pyrazol-1-yl)propanoate?
The molecular formula is C6H7BrN2O2.
What is the synonyms of Ethyl 3-(4-bromo-1H-pyrazol-1-yl)propanoate?
The synonyms are 3-(4-bromopyrazol-1-yl)propanoic acid, 925146-35-6, 3-(4-bromopyrazol-1-yl)propanoic Acid, 3-(4-Bromo-1h-pyrazol-1-yl)propanoic acid hydrochloride, 3-(4-Bromo-pyrazol-1-yl)-propionic acid, and more.
What is the molecular weight of Ethyl 3-(4-bromo-1H-pyrazol-1-yl)propanoate?
The molecular weight is 219.04 g/mol.
What is the IUPAC name of Ethyl 3-(4-bromo-1H-pyrazol-1-yl)propanoate?
The IUPAC name is 3-(4-bromopyrazol-1-yl)propanoic acid.
What is the InChI of Ethyl 3-(4-bromo-1H-pyrazol-1-yl)propanoate?
The InChI is InChI=1S/C6H7BrN2O2/c7-5-3-8-9(4-5)2-1-6(10)11/h3-4H,1-2H2,(H,10,11).
What is the InChIKey of Ethyl 3-(4-bromo-1H-pyrazol-1-yl)propanoate?
The InChIKey is FUQHYUVPDLMICC-UHFFFAOYSA-N.
What is the Canonical SMILES of Ethyl 3-(4-bromo-1H-pyrazol-1-yl)propanoate?
The Canonical SMILES is C1=C(C=NN1CCC(=O)O)Br.
What is the CAS number of Ethyl 3-(4-bromo-1H-pyrazol-1-yl)propanoate?
The CAS number is 925146-35-6.
What is the European Community (EC) number of Ethyl 3-(4-bromo-1H-pyrazol-1-yl)propanoate?
The European Community (EC) number is 675-274-3.
※ Please kindly note that our products are for research use only.