The molecular formula of the compound is C14H17N3O4.
What are the synonyms of the compound?
The synonyms of the compound are 92440-76-1, 4-Desamino-4-hydroxy trimethoprim, 2-Amino-5-[(3,4,5-trimethoxyphenyl)methyl]-4(1H)-pyrimidinone, and 2-amino-5-[(3,4,5-trimethoxyphenyl)methyl]-1H-pyrimidin-6-one.
What is the molecular weight of the compound?
The molecular weight of the compound is 291.30 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-amino-5-[(3,4,5-trimethoxyphenyl)methyl]-1H-pyrimidin-6-one.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C14H17N3O4/c1-19-10-5-8(6-11(20-2)12(10)21-3)4-9-7-16-14(15)17-13(9)18/h5-7H,4H2,1-3H3,(H3,15,16,17,18).
What is the InChIKey of the compound?
The InChIKey of the compound is ZKFZTBRMADDRMK-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is COC1=CC(=CC(=C1OC)OC)CC2=CN=C(NC2=O)N.
What is the CAS number of the compound?
The CAS number of the compound is 92440-76-1.
What is the molecular weight of the compound according to PubChem?
The molecular weight of the compound is 291.30 g/mol according to PubChem.
Is the compound canonicalized?
Yes, the compound is canonicalized according to PubChem.
※ Please kindly note that our products are for research use only.