What is the molecular formula of Ethyl thiopropionate?
The molecular formula of Ethyl thiopropionate is C5H10OS.
What is the molecular weight of Ethyl thiopropionate?
The molecular weight of Ethyl thiopropionate is 118.20 g/mol.
What is the IUPAC name of Ethyl thiopropionate?
The IUPAC name of Ethyl thiopropionate is S-ethyl propanethioate.
What is the InChI of Ethyl thiopropionate?
The InChI of Ethyl thiopropionate is InChI=1S/C5H10OS/c1-3-5(6)7-4-2/h3-4H2,1-2H3.
What is the InChIKey of Ethyl thiopropionate?
The InChIKey of Ethyl thiopropionate is HNEVHBHRLCAKKQ-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl thiopropionate?
The canonical SMILES of Ethyl thiopropionate is CCC(=O)SCC.
What is the CAS number of Ethyl thiopropionate?
The CAS number of Ethyl thiopropionate is 2432-42-0.
What is the EC number of Ethyl thiopropionate?
The EC number of Ethyl thiopropionate is 219-405-0.
What is the DSSTox Substance ID of Ethyl thiopropionate?
The DSSTox Substance ID of Ethyl thiopropionate is DTXSID00179063.
Is Ethyl thiopropionate a canonicalized compound?
Yes, Ethyl thiopropionate is a canonicalized compound.