What is the molecular formula of 4-Ethyl-2,5-dimethoxybenzeneethanamine hydrochloride?
The molecular formula is C12H20ClNO2.
What is the molecular weight of 4-Ethyl-2,5-dimethoxybenzeneethanamine hydrochloride?
The molecular weight is 245.74 g/mol.
What is the IUPAC name of 4-Ethyl-2,5-dimethoxybenzeneethanamine hydrochloride?
The IUPAC name is 2-(4-ethyl-2,5-dimethoxyphenyl)ethanamine hydrochloride.
What is the InChI of 4-Ethyl-2,5-dimethoxybenzeneethanamine hydrochloride?
The InChI is InChI=1S/C12H19NO2.ClH/c1-4-9-7-12(15-3)10(5-6-13)8-11(9)14-2;/h7-8H,4-6,13H2,1-3H3;1H.
What is the InChIKey of 4-Ethyl-2,5-dimethoxybenzeneethanamine hydrochloride?
The InChIKey is CTDRFXSMYFXGIH-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Ethyl-2,5-dimethoxybenzeneethanamine hydrochloride?
The canonical SMILES is CCC1=CC(=C(C=C1OC)CCN)OC.Cl.
What is the CAS number of 4-Ethyl-2,5-dimethoxybenzeneethanamine hydrochloride?
The CAS number is 923013-67-6.
How many hydrogen bond donor counts does 4-Ethyl-2,5-dimethoxybenzeneethanamine hydrochloride have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Ethyl-2,5-dimethoxybenzeneethanamine hydrochloride have?
It has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 4-Ethyl-2,5-dimethoxybenzeneethanamine hydrochloride have?
It has 5 rotatable bond counts.