The IUPAC Name of sanggenon M is (3R,11S)-7,11,14-trihydroxy-18,18-dimethyl-3-(3-methylbut-2-enyl)-2,10,17-trioxapentacyclo[11.8.0.0 3,11 .0 4,9 .0 16,21 ]henicosa-1(13),4(9),5,7,14,16(21),19-heptaen-12-one.
How is the Canonical SMILES of sanggenon M represented?
The Canonical SMILES of sanggenon M is represented as CC(=CCC12C3=C(C=C(C=C3)O)OC1(C(=O)C4=C(O2)C5=C(C=C4O)OC(C=C5)(C)C)O)C.
What is the InChIKey of sanggenon M?
The InChIKey of sanggenon M is DBROKYAXMOREQD-JWQCQUIFSA-N.
What is the molecular weight of sanggenon M?
The molecular weight of sanggenon M is 436.5 g/mol.
How many hydrogen bond donor counts does sanggenon M have?
Sanggenon M has a hydrogen bond donor count of 3.
How many rotatable bond counts does sanggenon M have?
Sanggenon M has a rotatable bond count of 2.
What is the topological polar surface area of sanggenon M?
The topological polar surface area of sanggenon M is 105 Å^2.
How many heavy atom counts does sanggenon M have?
Sanggenon M has a heavy atom count of 32.
※ Please kindly note that our products are for research use only.