What is the molecular formula of p-Hydroxy-bz-ala-phe-oh?
The molecular formula is C19H20N2O5.
What is the molecular weight of p-Hydroxy-bz-ala-phe-oh?
The molecular weight is 356.4 g/mol.
What is the IUPAC name of p-Hydroxy-bz-ala-phe-oh?
The IUPAC name is (2S)-2-[[(2S)-2-[(4-hydroxybenzoyl)amino]propanoyl]amino]-3-phenylpropanoic acid.
What is the InChI of p-Hydroxy-bz-ala-phe-oh?
The InChI is InChI=1S/C19H20N2O5/c1-12(20-18(24)14-7-9-15(22)10-8-14)17(23)21-16(19(25)26)11-13-5-3-2-4-6-13/h2-10,12,16,22H,11H2,1H3,(H,20,24)(H,21,23)(H,25,26)/t12-,16-/m0/s1.
What is the InChIKey of p-Hydroxy-bz-ala-phe-oh?
The InChIKey is YFRDJBIRQUPNRA-LRDDRELGSA-N.
What is the canonical SMILES of p-Hydroxy-bz-ala-phe-oh?
The canonical SMILES is CC(C(=O)NC(CC1=CC=CC=C1)C(=O)O)NC(=O)C2=CC=C(C=C2)O.
What is the isomeric SMILES of p-Hydroxy-bz-ala-phe-oh?
The isomeric SMILES is C[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)NC(=O)C2=CC=C(C=C2)O.
What is the XLogP3 of p-Hydroxy-bz-ala-phe-oh?
The XLogP3 is 1.5.
How many hydrogen bond donor counts are there in p-Hydroxy-bz-ala-phe-oh?
There are 4 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in p-Hydroxy-bz-ala-phe-oh?
There are 5 hydrogen bond acceptor counts.