What is the molecular formula of Hydroxybupropione?
The molecular formula of Hydroxybupropione is C13H18ClNO2.
When was Hydroxybupropione created?
Hydroxybupropione was created on June 23, 2005.
What is the IUPAC Name of Hydroxybupropione?
The IUPAC Name of Hydroxybupropione is 1-(3-chlorophenyl)-2-[(1-hydroxy-2-methylpropan-2-yl)amino]propan-1-one.
How is the InChI of Hydroxybupropione represented?
The InChI of Hydroxybupropione is represented as InChI=1S/C13H18ClNO2/c1-9(15-13(2,3)8-16)12(17)10-5-4-6-11(14)7-10/h4-7,9,15-16H,8H2,1-3H3.
What is the Canonical SMILES of Hydroxybupropione?
The Canonical SMILES of Hydroxybupropione is CC(C(=O)C1=CC(=CC=C1)Cl)NC(C)(C)CO.
What is the molecular weight of Hydroxybupropione?
The molecular weight of Hydroxybupropione is 255.74 g/mol.
How many Hydrogen Bond Donor Counts does Hydroxybupropione have?
Hydroxybupropione has 2 Hydrogen Bond Donor Counts.
What is the topological polar surface area of Hydroxybupropione?
The topological polar surface area of Hydroxybupropione is 49.3 Ų.
Does Hydroxybupropione have any defined atom stereocenter counts?
No, Hydroxybupropione does not have any defined atom stereocenter counts.
What is the formal charge of Hydroxybupropione?
The formal charge of Hydroxybupropione is 0.