What is the molecular formula of 2-Bromo-3-furonitrile?
The molecular formula of 2-Bromo-3-furonitrile is C5H2BrNO.
What is the molecular weight of 2-Bromo-3-furonitrile?
The molecular weight of 2-Bromo-3-furonitrile is 171.98 g/mol.
When was 2-Bromo-3-furonitrile created and last modified?
2-Bromo-3-furonitrile was created on February 29, 2008, and last modified on December 30, 2023.
What is the IUPAC name of 2-Bromo-3-furonitrile?
The IUPAC name of 2-Bromo-3-furonitrile is 2-bromofuran-3-carbonitrile.
What is the InChI of 2-Bromo-3-furonitrile?
The InChI of 2-Bromo-3-furonitrile is InChI=1S/C5H2BrNO/c6-5-4(3-7)1-2-8-5/h1-2H.
What is the InChIKey of 2-Bromo-3-furonitrile?
The InChIKey of 2-Bromo-3-furonitrile is NVOHYBBWRRHLKB-UHFFFAOYSA-N.
How many hydrogen bond acceptors does 2-Bromo-3-furonitrile have?
2-Bromo-3-furonitrile has 2 hydrogen bond acceptors.
What is the topological polar surface area of 2-Bromo-3-furonitrile?
The topological polar surface area of 2-Bromo-3-furonitrile is 36.9 Ų.
How many rotatable bond counts does 2-Bromo-3-furonitrile have?
2-Bromo-3-furonitrile has 0 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Download
![2-[4-(Chloromethyl)phenoxy]-6-methylpyrazine](https://resource.alfa-chemistry.com/structure/921939-00-6.gif)
![4-Piperidinemethanamine,N-methyl-1-thieno[3,2-d]pyrimidin-4-yl-](https://resource.alfa-chemistry.com/structure/921939-04-0.gif)
