What is the molecular formula of (R)-Pyrrolidinol?
The molecular formula of (R)-Pyrrolidinol is C9H13N3O.
What are the synonyms for (R)-Pyrrolidinol?
The synonyms for (R)-Pyrrolidinol are (R)-1-(5-Aminopyridin-2-yl)pyrrolidin-3-ol, (3R)-1-(5-aminopyridin-2-yl)pyrrolidin-3-ol, (r)-pyrrolidinol, 1-(5-Amino-2-pyridinyl)-3-(R)-pyrrolidinol.
What is the molecular weight of (R)-Pyrrolidinol?
The molecular weight of (R)-Pyrrolidinol is 179.22 g/mol.
What is the IUPAC name of (R)-Pyrrolidinol?
The IUPAC name of (R)-Pyrrolidinol is (3R)-1-(5-aminopyridin-2-yl)pyrrolidin-3-ol.
What is the InChI for (R)-Pyrrolidinol?
The InChI for (R)-Pyrrolidinol is InChI=1S/C9H13N3O/c10-7-1-2-9(11-5-7)12-4-3-8(13)6-12/h1-2,5,8,13H,3-4,6,10H2/t8-/m1/s1.
What is the InChIKey for (R)-Pyrrolidinol?
The InChIKey for (R)-Pyrrolidinol is KTZANZYEZRAGNO-MRVPVSSYSA-N.
What is the canonical SMILES for (R)-Pyrrolidinol?
The canonical SMILES for (R)-Pyrrolidinol is C1CN(CC1O)C2=NC=C(C=C2)N.
How many hydrogen bond donor counts does (R)-Pyrrolidinol have?
(R)-Pyrrolidinol has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does (R)-Pyrrolidinol have?
(R)-Pyrrolidinol has 4 hydrogen bond acceptor counts.