The molecular formula of the compound is C13H19Cl2NO2.
What are the synonyms for the compound?
The synonyms for the compound are N-Benzyl-N-(2-chloroethyl)-beta-alanine methyl ester hydrochloride and 92105-56-1 beta-ALANINE, N-BENZYL-N-(2-CHLOROETHYL)-, METHYL ESTER, HYDROCHLORIDE.
What is the molecular weight of the compound?
The molecular weight of the compound is 292.20 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is benzyl-(2-chloroethyl)-(3-methoxy-3-oxopropyl)azanium;chloride.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C13H18ClNO2.ClH/c1-17-13(16)7-9-15(10-8-14)11-12-5-3-2-4-6-12;/h2-6H,7-11H2,1H3;1H.
What is the InChIKey of the compound?
The InChIKey of the compound is VFERURGQBKVBDV-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is COC(=O)CC[NH+](CCCl)CC1=CC=CC=C1.[Cl-].
What is the CAS number of the compound?
The CAS number of the compound is 92105-56-1.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many rotatable bond counts does the compound have?
The compound has 8 rotatable bond counts.
※ Please kindly note that our products are for research use only.