What is the molecular formula of Naphthol AS-MX?
The molecular formula of Naphthol AS-MX is C19H17NO2.
What is the molecular weight of Naphthol AS-MX?
The molecular weight of Naphthol AS-MX is 291.3 g/mol.
What is the IUPAC name of Naphthol AS-MX?
The IUPAC name of Naphthol AS-MX is N-(2,4-dimethylphenyl)-3-hydroxynaphthalene-2-carboxamide.
What is the InChI of Naphthol AS-MX?
The InChI of Naphthol AS-MX is InChI=1S/C19H17NO2/c1-12-7-8-17(13(2)9-12)20-19(22)16-10-14-5-3-4-6-15(14)11-18(16)21/h3-11,21H,1-2H3,(H,20,22).
What is the InChIKey of Naphthol AS-MX?
The InChIKey of Naphthol AS-MX is VTPSNRIENVXKCI-UHFFFAOYSA-N.
What is the canonical SMILES of Naphthol AS-MX?
The canonical SMILES of Naphthol AS-MX is CC1=CC(=C(C=C1)NC(=O)C2=CC3=CC=CC=C3C=C2O)C.
What is the CAS number of Naphthol AS-MX?
The CAS number of Naphthol AS-MX is 92-75-1.
What is the European Community (EC) number of Naphthol AS-MX?
The European Community (EC) number of Naphthol AS-MX is 202-186-0.
What is the DSSTox Substance ID of Naphthol AS-MX?
The DSSTox Substance ID of Naphthol AS-MX is DTXSID7059064.
What is the formal charge of Naphthol AS-MX?
The formal charge of Naphthol AS-MX is 0.