What is the molecular formula of N,N-Diethyl-m-anisidine?
The molecular formula of N,N-Diethyl-m-anisidine is C11H17NO.
What is the molecular weight of N,N-Diethyl-m-anisidine?
The molecular weight of N,N-Diethyl-m-anisidine is 179.26 g/mol.
What is the IUPAC name of N,N-Diethyl-m-anisidine?
The IUPAC name of N,N-Diethyl-m-anisidine is N,N-diethyl-3-methoxyaniline.
What is the InChI of N,N-Diethyl-m-anisidine?
The InChI of N,N-Diethyl-m-anisidine is InChI=1S/C11H17NO/c1-4-12(5-2)10-7-6-8-11(9-10)13-3/h6-9H,4-5H2,1-3H3.
What is the InChIKey of N,N-Diethyl-m-anisidine?
The InChIKey of N,N-Diethyl-m-anisidine is KGFAREHEJGDILZ-UHFFFAOYSA-N.
What is the canonical SMILES of N,N-Diethyl-m-anisidine?
The canonical SMILES of N,N-Diethyl-m-anisidine is CCN(CC)C1=CC(=CC=C1)OC.
What is the CAS number of N,N-Diethyl-m-anisidine?
The CAS number of N,N-Diethyl-m-anisidine is 92-18-2.
What is the EC number of N,N-Diethyl-m-anisidine?
The EC number of N,N-Diethyl-m-anisidine is 202-134-7.
What is the XLogP3-AA value of N,N-Diethyl-m-anisidine?
The XLogP3-AA value of N,N-Diethyl-m-anisidine is 2.7.
Is N,N-Diethyl-m-anisidine a canonicalized compound?
Yes, N,N-Diethyl-m-anisidine is a canonicalized compound.