92018-57-0 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula is C12H18N2O3.
The molecular weight is 238.28 g/mol.
The IUPAC name is N-[3-[bis(2-hydroxyethyl)amino]phenyl]acetamide.
The InChI is InChI=1S/C12H18N2O3/c1-10(17)13-11-3-2-4-12(9-11)14(5-7-15)6-8-16/h2-4,9,15-16H,5-8H2,1H3,(H,13,17).
The InChIKey BPAFLIGSSPTQHU-UHFFFAOYSA-N.
The canonical SMILES is CC(=O)NC1=CC(=CC=C1)N(CCO)CCO.
The CAS number is 92-02-4.
The European Community (EC) number is 202-117-4.
The hydrogen bond donor count is 3.
The hydrogen bond acceptor count is 4.