What is the molecular formula of the compound with PubChem CID 848604?
The molecular formula is C12H10N2O2S.
What are the synonyms of the compound with PubChem CID 848604?
The synonyms are N-(4-formyl-1,3-thiazol-2-yl)-N-phenylacetamide, 91973-74-9, N-(4-Formylthiazol-2-yl)-N-phenylacetamide, DTXSID10357254, AKOS000118547, and more.
What is the molecular weight of the compound with PubChem CID 848604?
The molecular weight is 246.29 g/mol.
What is the IUPAC name of the compound with PubChem CID 848604?
The IUPAC name is N-(4-formyl-1,3-thiazol-2-yl)-N-phenylacetamide.
What is the InChI of the compound with PubChem CID 848604?
The InChI is InChI=1S/C12H10N2O2S/c1-9(16)14(11-5-3-2-4-6-11)12-13-10(7-15)8-17-12/h2-8H,1H3.
What is the InChIKey of the compound with PubChem CID 848604?
The InChIKey is UPSVWABECCOHRT-UHFFFAOYSA-N.
What is the canonical SMILES of the compound with PubChem CID 848604?
The canonical SMILES is CC(=O)N(C1=CC=CC=C1)C2=NC(=CS2)C=O.
What is the CAS number of the compound with PubChem CID 848604?
The CAS number is 91973-74-9.
What is the XLogP3-AA value of the compound with PubChem CID 848604?
The XLogP3-AA value is 2.
Is the compound with PubChem CID 848604 a canonicalized compound?
Yes, the compound is canonicalized according to PubChem.
※ Please kindly note that our products are for research use only.