What is the PubChem CID for Baq?
The PubChem CID for Baq is 83881.
What is the molecular formula of Baq?
The molecular formula of Baq is C19H22N4O2S.
What are the synonyms for Baq?
The synonyms for Baq include Biotinyl-6-aminoquinoline, 91853-89-3, and 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-quinolin-6-ylpentanamide.
What is the molecular weight of Baq?
The molecular weight of Baq is 370.5 g/mol.
When was Baq created and modified in PubChem?
Baq was created in PubChem on August 8, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Baq?
The IUPAC name of Baq is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-quinolin-6-ylpentanamide.
What is the InChI of Baq?
The InChI of Baq is InChI=1S/C19H22N4O2S/c24-17(21-13-7-8-14-12(10-13)4-3-9-20-14)6-2-1-5-16-18-15(11-26-16)22-19(25)23-18/h3-4,7-10,15-16,18H,1-2,5-6,11H2,(H,21,24)(H2,22,23,25)/t15-,16-,18-/m0/s1.
What is the InChIKey of Baq?
The InChIKey of Baq is LQDCDPSBDPBXMX-BQFCYCMXSA-N.
What is the canonical SMILES of Baq?
The canonical SMILES of Baq is C1C2C(C(S1)CCCCC(=O)NC3=CC4=C(C=C3)N=CC=C4)NC(=O)N2.
What is the isomeric SMILES of Baq?
The isomeric SMILES of Baq is C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NC3=CC4=C(C=C3)N=CC=C4)NC(=O)N2.