91771-97-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is dimethoxyphosphorylmethoxy-(2-ethoxyethyl)-sulfanylidenephosphanium.
The InChI of the compound is InChI=1S/C7H17O5P2S/c1-4-11-5-6-13(15)12-7-14(8,9-2)10-3/h4-7H2,1-3H3/q+1.
The InChIKey of the compound is UCGXCENXJFJLFU-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCOCC[P+](=S)OCP(=O)(OC)OC.
The molecular weight of the compound is 275.22 g/mol.
The XLogP3-AA value of the compound is 0.8.
The compound has 0 hydrogen bond donor counts.
The compound has 6 hydrogen bond acceptor counts.
The compound has 9 rotatable bond counts.
Yes, the compound is canonicalized.