The molecular formula of the compound is C18H16N4O2.
What are the synonyms for the compound?
The synonyms for the compound are 917392-54-2, Methyl 4-methyl-3-((4-(pyridin-3-yl)pyrimidin-2-yl)amino)benzoate, 4-METHYL-3-[[4-(3-PYRIDINYL)-2-PYRIMIDINYL]AMINO]BENZOIC ACID METHYL ESTER, HKX2YWY42Y, methyl 4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzoate.
What is the molecular weight of the compound?
The molecular weight of the compound is 320.3 g/mol.
When was the compound created and last modified?
The compound was created on November 14, 2007, and last modified on October 21, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is methyl 4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzoate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C18H16N4O2/c1-12-5-6-13(17(23)24-2)10-16(12)22-18-20-9-7-15(21-18)14-4-3-8-19-11-14/h3-11H,1-2H3,(H,20,21,22).
What is the InChIKey of the compound?
The InChIKey of the compound is BECBKQYLJDEVDN-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CC1=C(C=C(C=C1)C(=O)OC)NC2=NC=CC(=N2)C3=CN=CC=C3.
What is the CAS number of the compound?
The CAS number of the compound is 917392-54-2.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.9.
※ Please kindly note that our products are for research use only.