What is the molecular formula of (Z)-Fluvoxamine?
The molecular formula of (Z)-Fluvoxamine is C15H21F3N2O2.
What is the molecular weight of (Z)-Fluvoxamine?
The molecular weight of (Z)-Fluvoxamine is 318.33 g/mol.
What is the IUPAC Name of (Z)-Fluvoxamine?
The IUPAC Name of (Z)-Fluvoxamine is 2-[(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethanamine.
What is the InChIKey of (Z)-Fluvoxamine?
The InChIKey of (Z)-Fluvoxamine is CJOFXWAVKWHTFT-XSFVSMFZSA-N.
What is the Canonical SMILES of (Z)-Fluvoxamine?
The Canonical SMILES of (Z)-Fluvoxamine is COCCCCC(=NOCCN)C1=CC=C(C=C1)C(F)(F)F.
What is the CAS number of (Z)-Fluvoxamine?
The CAS number of (Z)-Fluvoxamine is 54739-18-3.
What is the ChEMBL ID of (Z)-Fluvoxamine?
The ChEMBL ID of (Z)-Fluvoxamine is CHEMBL814.
What is the KEGG ID of (Z)-Fluvoxamine?
The KEGG ID of (Z)-Fluvoxamine is C07571.
What is the NCI Thesaurus Code of (Z)-Fluvoxamine?
The NCI Thesaurus Code of (Z)-Fluvoxamine is C61769.
What is the Wikipedia page for (Z)-Fluvoxamine?
The Wikipedia page for (Z)-Fluvoxamine is "Fluvoxamine".
Download
![3-(Endo-9-fluorenylmethoxycarbonylamino)bicyclo[2.2.1]heptane-2-endo-carboxylic acid](https://resource.alfa-chemistry.com/structure/917098-99-8.gif)
![4-Pentenoicacid,2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-4-methyl-,(2R)-](https://resource.alfa-chemistry.com/structure/917099-00-4.gif)
