What is the molecular formula of Chembrdg-bb 9071018?
The molecular formula of Chembrdg-bb 9071018 is C12H21NO3.
What is the molecular weight of Chembrdg-bb 9071018?
The molecular weight of Chembrdg-bb 9071018 is 227.30 g/mol.
What is the IUPAC name of Chembrdg-bb 9071018?
The IUPAC name of Chembrdg-bb 9071018 is 3-(dimethylcarbamoyl)-1,2,2-trimethylcyclopentane-1-carboxylic acid.
What is the InChI of Chembrdg-bb 9071018?
The InChI of Chembrdg-bb 9071018 is InChI=1S/C12H21NO3/c1-11(2)8(9(14)13(4)5)6-7-12(11,3)10(15)16/h8H,6-7H2,1-5H3,(H,15,16).
What is the InChIKey of Chembrdg-bb 9071018?
The InChIKey of Chembrdg-bb 9071018 is RCADQIRMKGJSHI-UHFFFAOYSA-N.
What is the canonical SMILES of Chembrdg-bb 9071018?
The canonical SMILES of Chembrdg-bb 9071018 is CC1(C(CCC1(C)C(=O)O)C(=O)N(C)C).
What is the CAS number of Chembrdg-bb 9071018?
The CAS number of Chembrdg-bb 9071018 is 91691-00-8.
What is the XLogP3-AA value of Chembrdg-bb 9071018?
The XLogP3-AA value of Chembrdg-bb 9071018 is 1.3.
How many hydrogen bond donor counts does Chembrdg-bb 9071018 have?
Chembrdg-bb 9071018 has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Chembrdg-bb 9071018 have?
Chembrdg-bb 9071018 has 3 hydrogen bond acceptor counts.