What is the molecular formula of 3-Butylpyrazinamine?
The molecular formula is C8H15N3.
What is the molecular weight of 3-Butylpyrazinamine?
The molecular weight is 153.22 g/mol.
When was 3-Butylpyrazinamine created?
It was created on January 24, 2012.
When was 3-Butylpyrazinamine last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of 3-Butylpyrazinamine?
The IUPAC name is 3-butyl-2H-pyrazin-1-amine.
What is the InChI of 3-Butylpyrazinamine?
The InChI is InChI=1S/C8H15N3/c1-2-3-4-8-7-11(9)6-5-10-8/h5-6H,2-4,7,9H2,1H3.
What is the InChIKey of 3-Butylpyrazinamine?
The InChIKey is NJOLLAVTQJZYCZ-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Butylpyrazinamine?
The canonical SMILES is CCCCC1=NC=CN(C1)N.
What is the XLogP3-AA value of 3-Butylpyrazinamine?
The XLogP3-AA value is 0.8.
How many hydrogen bond donor counts does 3-Butylpyrazinamine have?
It has 1 hydrogen bond donor count.