What is the molecular formula of 2-Fluoro-3-iodotoluene?
The molecular formula of 2-Fluoro-3-iodotoluene is C7H6FI.
When was 2-Fluoro-3-iodotoluene created and modified?
2-Fluoro-3-iodotoluene was created on 2008-06-26 and modified on 2023-12-30.
What is the IUPAC name of 2-Fluoro-3-iodotoluene?
The IUPAC name of 2-Fluoro-3-iodotoluene is 2-fluoro-1-iodo-3-methylbenzene.
What is the InChI representation of 2-Fluoro-3-iodotoluene?
The InChI representation of 2-Fluoro-3-iodotoluene is InChI=1S/C7H6FI/c1-5-3-2-4-6(9)7(5)8/h2-4H,1H3.
What is the Canonical SMILES representation of 2-Fluoro-3-iodotoluene?
The Canonical SMILES representation of 2-Fluoro-3-iodotoluene is CC1=C(C(=CC=C1)I)F.
What is the molecular weight of 2-Fluoro-3-iodotoluene?
The molecular weight of 2-Fluoro-3-iodotoluene is 236.02 g/mol.
How many hydrogen bond donor counts does 2-Fluoro-3-iodotoluene have?
2-Fluoro-3-iodotoluene has 0 hydrogen bond donor counts.
What is the topological polar surface area of 2-Fluoro-3-iodotoluene?
The topological polar surface area of 2-Fluoro-3-iodotoluene is 0-2.
Is 2-Fluoro-3-iodotoluene a canonicalized compound?
Yes, 2-Fluoro-3-iodotoluene is a canonicalized compound.
How many rotatable bond counts does 2-Fluoro-3-iodotoluene have?
2-Fluoro-3-iodotoluene has 0 rotatable bond counts.