What is the molecular formula of Chembrdg-bb 9071915?
The molecular formula of Chembrdg-bb 9071915 is C12H15ClN2O.
When was Chembrdg-bb 9071915 created?
Chembrdg-bb 9071915 was created on May 28, 2009.
What is the IUPAC name of Chembrdg-bb 9071915?
The IUPAC name of Chembrdg-bb 9071915 is 2-chloro-N-(3-pyrrolidin-1-ylphenyl)acetamide.
What is the InChI of Chembrdg-bb 9071915?
The InChI of Chembrdg-bb 9071915 is InChI=1S/C12H15ClN2O/c13-9-12(16)14-10-4-3-5-11(8-10)15-6-1-2-7-15/h3-5,8H,1-2,6-7,9H2,(H,14,16).
What is the Canonical SMILES of Chembrdg-bb 9071915?
The Canonical SMILES of Chembrdg-bb 9071915 is C1CCN(C1)C2=CC=CC(=C2)NC(=O)CCl.
What is the molecular weight of Chembrdg-bb 9071915?
The molecular weight of Chembrdg-bb 9071915 is 238.71 g/mol.
How many hydrogen bond donor counts does Chembrdg-bb 9071915 have?
Chembrdg-bb 9071915 has 1 hydrogen bond donor count.
What is the topological polar surface area of Chembrdg-bb 9071915?
The topological polar surface area of Chembrdg-bb 9071915 is 32.3 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
What is the XLogP3-AA value of Chembrdg-bb 9071915?
The XLogP3-AA value of Chembrdg-bb 9071915 is 2.3.