What is the molecular formula of Akos bc-1937?
The molecular formula of Akos bc-1937 is C12H19NO.
When was Akos bc-1937 created and last modified according to PubChem?
Akos bc-1937 was created on December 5, 2007, and last modified on December 30, 2023.
What is the IUPAC name of Akos bc-1937?
The IUPAC name of Akos bc-1937 is 3-(2,3-dimethylphenoxy)-N-methylpropan-1-amine.
What is the InChI of Akos bc-1937?
The InChI of Akos bc-1937 is InChI=1S/C12H19NO/c1-10-6-4-7-12(11(10)2)14-9-5-8-13-3/h4,6-7,13H,5,8-9H2,1-3H3
What is the InChIKey of Akos bc-1937?
The InChIKey of Akos bc-1937 is CBKXZUFRYJGKDB-UHFFFAOYSA-N
What is the canonical SMILES representation of Akos bc-1937?
The canonical SMILES representation of Akos bc-1937 is CC1=C(C(=CC=C1)OCCCNC)C
What is the molecular weight of Akos bc-1937?
The molecular weight of Akos bc-1937 is 193.28 g/mol.
How many hydrogen bond donor counts does Akos bc-1937 have?
Akos bc-1937 has 1 hydrogen bond donor count.
What is the topological polar surface area of Akos bc-1937?
The topological polar surface area of Akos bc-1937 is 21.3 Å^2.
Is the compound canonicalized according to PubChem?
Yes, the compound Akos bc-1937 is canonicalized according to PubChem.